C20H24N2O5 — CID 10044790
[1-ethoxy-2-(1H-imidazol-5-ylmethyl)-5-methyl-1,3-dioxohexan-2-yl] benzoate (PubChem CID 10044790) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is [1-ethoxy-2-(1H-imidazol-5-ylmethyl)-5-methyl-1,3-dioxohexan-2-yl] benzoate.
| Compound Name | [1-ethoxy-2-(1H-imidazol-5-ylmethyl)-5-methyl-1,3-dioxohexan-2-yl] benzoate |
|---|---|
| PubChem CID | 10044790 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [1-ethoxy-2-(1H-imidazol-5-ylmethyl)-5-methyl-1,3-dioxohexan-2-yl] benzoate |
| SMILES | CCOC(=O)C(Cc1cnc[nH]1)(OC(=O)c1ccccc1)C(=O)CC(C)C |
| InChI | InChI=1S/C20H24N2O5/c1-4-26-19(25)20(17(23)10-14(2)3,11-16-12-21-13-22-16)27-18(24)15-8-6-5-7-9-15/h5-9,12-14H,4,10-11H2,1-3H3,(H,21,22) |
| InChIKey | CQIIZQRNUQQBPX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|