C24H30N2O2 — CID 10045227
[(1S,6S,8aR)-6-(dibenzylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate (PubChem CID 10045227) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [(1S,6S,8aR)-6-(dibenzylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate.
| Compound Name | [(1S,6S,8aR)-6-(dibenzylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
|---|---|
| PubChem CID | 10045227 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(1S,6S,8aR)-6-(dibenzylamino)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN2C[C@@H](N(Cc3ccccc3)Cc3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C24H30N2O2/c1-19(27)28-24-14-15-25-18-22(12-13-23(24)25)26(16-20-8-4-2-5-9-20)17-21-10-6-3-7-11-21/h2-11,22-24H,12-18H2,1H3/t22-,23+,24-/m0/s1 |
| InChIKey | GEPNOIKFSLBPFD-VXNXHJTFSA-N |
| XLogP | 3.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |