C21H25Cl2NO2 — CID 10046131
2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 10046131) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10046131 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1(N=C2C=C(Cl)C(=O)C(Cl)=C2)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C21H25Cl2NO2/c1-19(2,3)13-10-21(7,11-14(17(13)25)20(4,5)6)24-12-8-15(22)18(26)16(23)9-12/h8-11H,1-7H3 |
| InChIKey | BBWBTZFXOYUFQK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|