C24H31Cl2NO2 — CID 10252467
2,4,6-tritert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]cyclohexa-2,5-dien-1-one (PubChem CID 10252467) has the molecular formula C24H31Cl2NO2 and a molecular weight of 436.42 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,4,6-tritert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10252467 |
| Molecular Formula | C24H31Cl2NO2 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2,4,6-tritert-butyl-4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(N=C2C=C(Cl)C(=O)C(Cl)=C2)(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C24H31Cl2NO2/c1-21(2,3)15-12-24(23(7,8)9,13-16(19(15)28)22(4,5)6)27-14-10-17(25)20(29)18(26)11-14/h10-13H,1-9H3 |
| InChIKey | QXYTVNOABFIIGA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|