C19H23ClN2O4S — CID 10047212
8-[(4-chlorophenyl)sulfonylamino]-7-pyridin-3-yloctanoic acid (PubChem CID 10047212) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfonylamino]-7-pyridin-3-yloctanoic acid.
| Compound Name | 8-[(4-chlorophenyl)sulfonylamino]-7-pyridin-3-yloctanoic acid |
|---|---|
| PubChem CID | 10047212 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfonylamino]-7-pyridin-3-yloctanoic acid |
| SMILES | O=C(O)CCCCCC(CNS(=O)(=O)c1ccc(Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H23ClN2O4S/c20-17-8-10-18(11-9-17)27(25,26)22-14-16(15-6-4-12-21-13-15)5-2-1-3-7-19(23)24/h4,6,8-13,16,22H,1-3,5,7,14H2,(H,23,24) |
| InChIKey | SHYBZZCSPUTWDK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|