C24H33NO5 — CID 10047479
ethoxycarbonyl 2-[(1R,3S,5R)-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-5-methylcyclohexyl]acetate (PubChem CID 10047479) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethoxycarbonyl 2-[(1R,3S,5R)-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-5-methylcyclohexyl]acetate.
| Compound Name | ethoxycarbonyl 2-[(1R,3S,5R)-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-5-methylcyclohexyl]acetate |
|---|---|
| PubChem CID | 10047479 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | ethoxycarbonyl 2-[(1R,3S,5R)-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-5-methylcyclohexyl]acetate |
| SMILES | CCOC(=O)OC(=O)C[C@@H]1C[C@H](C)C[C@H](C[C@@H]2CCC(=O)N2Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H33NO5/c1-3-29-24(28)30-23(27)15-20-12-17(2)11-19(13-20)14-21-9-10-22(26)25(21)16-18-7-5-4-6-8-18/h4-8,17,19-21H,3,9-16H2,1-2H3/t17-,19+,20-,21+/m1/s1 |
| InChIKey | PRKJZASBBTWKHB-PMXSJFBMSA-N |
| XLogP | 4.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|