C23H31NO6 — CID 10409722
diethyl 2-acetyl-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]pentanedioate (PubChem CID 10409722) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is diethyl 2-acetyl-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]pentanedioate.
| Compound Name | diethyl 2-acetyl-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]pentanedioate |
|---|---|
| PubChem CID | 10409722 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | diethyl 2-acetyl-3-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]pentanedioate |
| SMILES | CCOC(=O)CC(C[C@@H]1CCC(=O)N1Cc1ccccc1)C(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C23H31NO6/c1-4-29-21(27)14-18(22(16(3)25)23(28)30-5-2)13-19-11-12-20(26)24(19)15-17-9-7-6-8-10-17/h6-10,18-19,22H,4-5,11-15H2,1-3H3/t18?,19-,22?/m0/s1 |
| InChIKey | QTGPCKOBWIBHFF-LVIWNVNYSA-N |
| XLogP | 2.91 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|