C23H23FN4O3 — CID 10047852
[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-[2-(3-fluorophenyl)-5-methylpyrazol-3-yl]methanone (PubChem CID 10047852) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-[2-(3-fluorophenyl)-5-methylpyrazol-3-yl]methanone.
| Compound Name | [4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-[2-(3-fluorophenyl)-5-methylpyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 10047852 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]-[2-(3-fluorophenyl)-5-methylpyrazol-3-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(c3ccc4c(c3)OCCO4)CC2)n(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C23H23FN4O3/c1-16-13-20(28(25-16)19-4-2-3-17(24)14-19)23(29)27-9-7-26(8-10-27)18-5-6-21-22(15-18)31-12-11-30-21/h2-6,13-15H,7-12H2,1H3 |
| InChIKey | RPCNKVXWWJPFOL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|