C20H27N3O5S3 — CID 10051082
methyl (2S)-2-[[4-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]dithiolane-4-carbonyl]amino]-3-phenylpropanoate (PubChem CID 10051082) has the molecular formula C20H27N3O5S3 and a molecular weight of 485.65 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]dithiolane-4-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[4-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]dithiolane-4-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10051082 |
| Molecular Formula | C20H27N3O5S3 |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | methyl (2S)-2-[[4-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]dithiolane-4-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)C1(NC(=O)[C@H](CCSC)NC=O)CSSC1 |
| InChI | InChI=1S/C20H27N3O5S3/c1-28-18(26)16(10-14-6-4-3-5-7-14)22-19(27)20(11-30-31-12-20)23-17(25)15(21-13-24)8-9-29-2/h3-7,13,15-16H,8-12H2,1-2H3,(H,21,24)(H,22,27)(H,23,25)/t15-,16-/m0/s1 |
| InChIKey | JEAFYQAJKYSNLM-HOTGVXAUSA-N |
| XLogP | 1.00 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|