C23H23NO4S2 — CID 100519635
ethyl 2-(N-(4-methylsulfanylphenyl)sulfonyl-2-phenylanilino)acetate (PubChem CID 100519635) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is ethyl 2-(N-(4-methylsulfanylphenyl)sulfonyl-2-phenylanilino)acetate.
| Compound Name | ethyl 2-(N-(4-methylsulfanylphenyl)sulfonyl-2-phenylanilino)acetate |
|---|---|
| PubChem CID | 100519635 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | ethyl 2-(N-(4-methylsulfanylphenyl)sulfonyl-2-phenylanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccccc1-c1ccccc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H23NO4S2/c1-3-28-23(25)17-24(30(26,27)20-15-13-19(29-2)14-16-20)22-12-8-7-11-21(22)18-9-5-4-6-10-18/h4-16H,3,17H2,1-2H3 |
| InChIKey | JYSJBHPVCNYSFG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |