C20H23NO6S2 — CID 100519815
ethyl 3-[(2-ethoxy-2-oxoethyl)-(4-methylsulfanylphenyl)sulfonylamino]benzoate (PubChem CID 100519815) has the molecular formula C20H23NO6S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 3-[(2-ethoxy-2-oxoethyl)-(4-methylsulfanylphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 3-[(2-ethoxy-2-oxoethyl)-(4-methylsulfanylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 100519815 |
| Molecular Formula | C20H23NO6S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl 3-[(2-ethoxy-2-oxoethyl)-(4-methylsulfanylphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)CN(c1cccc(C(=O)OCC)c1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C20H23NO6S2/c1-4-26-19(22)14-21(16-8-6-7-15(13-16)20(23)27-5-2)29(24,25)18-11-9-17(28-3)10-12-18/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | AGQRQMQJTZMNLP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |