C19H19N5O5S3 — CID 100523622
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 100523622) has the molecular formula C19H19N5O5S3 and a molecular weight of 493.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 100523622 |
| Molecular Formula | C19H19N5O5S3 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(C)Sc1nnc(NC(=O)CN(c2cccc([N+](=O)[O-])c2)S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C19H19N5O5S3/c1-13(2)30-19-22-21-18(31-19)20-17(25)12-23(14-7-6-8-15(11-14)24(26)27)32(28,29)16-9-4-3-5-10-16/h3-11,13H,12H2,1-2H3,(H,20,21,25) |
| InChIKey | ZSAYBPVWFVBBDN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|