C24H34N2O3 — CID 100527332
3-(3,4-diethoxyphenyl)-N-[[4-(diethylamino)phenyl]methyl]propanamide (PubChem CID 100527332) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-[[4-(diethylamino)phenyl]methyl]propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-[[4-(diethylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 100527332 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-[[4-(diethylamino)phenyl]methyl]propanamide |
| SMILES | CCOc1ccc(CCC(=O)NCc2ccc(N(CC)CC)cc2)cc1OCC |
| InChI | InChI=1S/C24H34N2O3/c1-5-26(6-2)21-13-9-20(10-14-21)18-25-24(27)16-12-19-11-15-22(28-7-3)23(17-19)29-8-4/h9-11,13-15,17H,5-8,12,16,18H2,1-4H3,(H,25,27) |
| InChIKey | UQELZRRTPSFYQD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|