C27H29N3O3S — CID 100530226
3-methyl-N-[(Z)-3-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 100530226) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-3-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(Z)-3-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 100530226 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-methyl-N-[(Z)-3-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2cccs2)C(=O)NCc2ccccc2CN2CCOCC2)c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-20-6-4-9-21(16-20)26(31)29-25(17-24-10-5-15-34-24)27(32)28-18-22-7-2-3-8-23(22)19-30-11-13-33-14-12-30/h2-10,15-17H,11-14,18-19H2,1H3,(H,28,32)(H,29,31)/b25-17- |
| InChIKey | IWEIRSBCWDFMEI-UQQQWYQISA-N |
| XLogP | 3.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|