C28H38N2O2 — CID 100533134
(2S)-N-cyclohexyl-2-[(2-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]butanamide (PubChem CID 100533134) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(2-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(2-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100533134 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(2-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1C)C(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H38N2O2/c1-4-26(28(32)29-25-12-6-5-7-13-25)30(20-24-11-9-8-10-22(24)3)27(31)19-18-23-16-14-21(2)15-17-23/h8-11,14-17,25-26H,4-7,12-13,18-20H2,1-3H3,(H,29,32)/t26-/m0/s1 |
| InChIKey | RUTRXFCSDYZBBY-SANMLTNESA-N |
| XLogP | 5.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |