C24H32N4O6S — CID 100536162
(2R)-N-[(2S)-butan-2-yl]-2-[(3-methylphenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide (PubChem CID 100536162) has the molecular formula C24H32N4O6S and a molecular weight of 504.61 g/mol. Its IUPAC name is (2R)-N-[(2S)-butan-2-yl]-2-[(3-methylphenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-[(2S)-butan-2-yl]-2-[(3-methylphenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100536162 |
| Molecular Formula | C24H32N4O6S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (2R)-N-[(2S)-butan-2-yl]-2-[(3-methylphenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide |
| SMILES | CC[C@H](C)NC(=O)[C@@H](C)N(Cc1cccc(C)c1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H32N4O6S/c1-6-18(3)25-24(30)19(4)26(15-20-10-7-9-17(2)13-20)23(29)16-27(35(5,33)34)21-11-8-12-22(14-21)28(31)32/h7-14,18-19H,6,15-16H2,1-5H3,(H,25,30)/t18-,19+/m0/s1 |
| InChIKey | GSVBMJVYZDLWOA-RBUKOAKNSA-N |
| XLogP | 3.00 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|