C23H29BrN4O6S — CID 133226581
2-[(4-bromophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-N-butan-2-ylpropanamide (PubChem CID 133226581) has the molecular formula C23H29BrN4O6S and a molecular weight of 569.48 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-N-butan-2-ylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 133226581 |
| Molecular Formula | C23H29BrN4O6S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H29BrN4O6S/c1-5-16(2)25-23(30)17(3)26(14-18-9-11-19(24)12-10-18)22(29)15-27(35(4,33)34)20-7-6-8-21(13-20)28(31)32/h6-13,16-17H,5,14-15H2,1-4H3,(H,25,30) |
| InChIKey | XXJDZRSBQWIUOF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|