C23H28Cl2N4O6S — CID 132740774
N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide (PubChem CID 132740774) has the molecular formula C23H28Cl2N4O6S and a molecular weight of 559.47 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide.
| Compound Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132740774 |
| Molecular Formula | C23H28Cl2N4O6S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | N-butan-2-yl-2-[(2,6-dichlorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H28Cl2N4O6S/c1-5-15(2)26-23(31)16(3)27(13-19-20(24)10-7-11-21(19)25)22(30)14-28(36(4,34)35)17-8-6-9-18(12-17)29(32)33/h6-12,15-16H,5,13-14H2,1-4H3,(H,26,31) |
| InChIKey | ZKJCECDAHNSING-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|