C30H35N3O6S — CID 10053655
diethyl 4-[2-[3-(benzoylcarbamothioylamino)propoxy]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10053655) has the molecular formula C30H35N3O6S and a molecular weight of 565.69 g/mol. Its IUPAC name is diethyl 4-[2-[3-(benzoylcarbamothioylamino)propoxy]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-[3-(benzoylcarbamothioylamino)propoxy]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10053655 |
| Molecular Formula | C30H35N3O6S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | diethyl 4-[2-[3-(benzoylcarbamothioylamino)propoxy]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1OCCCNC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H35N3O6S/c1-5-37-28(35)24-19(3)32-20(4)25(29(36)38-6-2)26(24)22-15-10-11-16-23(22)39-18-12-17-31-30(40)33-27(34)21-13-8-7-9-14-21/h7-11,13-16,26,32H,5-6,12,17-18H2,1-4H3,(H2,31,33,34,40) |
| InChIKey | GVELFRSXSIHMAL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|