C20H20N2O4S — CID 100537200
(E)-3-(3,4-dimethoxyphenyl)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)prop-2-enamide (PubChem CID 100537200) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 100537200 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)prop-2-enamide |
| SMILES | CCn1c(=O)sc2cc(NC(=O)/C=C/c3ccc(OC)c(OC)c3)ccc21 |
| InChI | InChI=1S/C20H20N2O4S/c1-4-22-15-8-7-14(12-18(15)27-20(22)24)21-19(23)10-6-13-5-9-16(25-2)17(11-13)26-3/h5-12H,4H2,1-3H3,(H,21,23)/b10-6+ |
| InChIKey | LBYGXFDTCOBSKX-UXBLZVDNSA-N |
| XLogP | 3.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|