C20H26N4O5 — CID 175673353
(E)-N-[1,3-diethyl-4-(methylamino)-2,6-dioxopyrimidin-5-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 175673353) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-N-[1,3-diethyl-4-(methylamino)-2,6-dioxopyrimidin-5-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1,3-diethyl-4-(methylamino)-2,6-dioxopyrimidin-5-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175673353 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (E)-N-[1,3-diethyl-4-(methylamino)-2,6-dioxopyrimidin-5-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCn1c(NC)c(NC(=O)/C=C/c2ccc(OC)c(OC)c2)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C20H26N4O5/c1-6-23-18(21-3)17(19(26)24(7-2)20(23)27)22-16(25)11-9-13-8-10-14(28-4)15(12-13)29-5/h8-12,21H,6-7H2,1-5H3,(H,22,25)/b11-9+ |
| InChIKey | UMCLEWKKTCHLPF-PKNBQFBNSA-N |
| XLogP | 1.76 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|