C24H34N4O6 — CID 54528547
N-(4-amino-1,3-dibutyl-2,6-dioxopyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 54528547) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-(4-amino-1,3-dibutyl-2,6-dioxopyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-amino-1,3-dibutyl-2,6-dioxopyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54528547 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-(4-amino-1,3-dibutyl-2,6-dioxopyrimidin-5-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | CCCCn1c(N)c(NC(=O)C=Cc2cc(OC)c(OC)c(OC)c2)c(=O)n(CCCC)c1=O |
| InChI | InChI=1S/C24H34N4O6/c1-6-8-12-27-22(25)20(23(30)28(24(27)31)13-9-7-2)26-19(29)11-10-16-14-17(32-3)21(34-5)18(15-16)33-4/h10-11,14-15H,6-9,12-13,25H2,1-5H3,(H,26,29) |
| InChIKey | YUWAVBKBYZZWPK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|