C22H18ClN3O4S2 — CID 100540799
4-chloro-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(phenylsulfamoyl)benzamide (PubChem CID 100540799) has the molecular formula C22H18ClN3O4S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 4-chloro-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(phenylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 100540799 |
| Molecular Formula | C22H18ClN3O4S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 4-chloro-N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(phenylsulfamoyl)benzamide |
| SMILES | CCn1c(=O)sc2cc(NC(=O)c3ccc(Cl)c(S(=O)(=O)Nc4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C22H18ClN3O4S2/c1-2-26-18-11-9-16(13-19(18)31-22(26)28)24-21(27)14-8-10-17(23)20(12-14)32(29,30)25-15-6-4-3-5-7-15/h3-13,25H,2H2,1H3,(H,24,27) |
| InChIKey | BXMYOELNBQSBDH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |