C10H17NO2 — CID 100542229
N-(cyclohexen-1-ylmethyl)-2-methoxyacetamide (PubChem CID 100542229) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(cyclohexen-1-ylmethyl)-2-methoxyacetamide.
| Compound Name | N-(cyclohexen-1-ylmethyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 100542229 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-(cyclohexen-1-ylmethyl)-2-methoxyacetamide |
| SMILES | COCC(=O)NCC1=CCCCC1 |
| InChI | InChI=1S/C10H17NO2/c1-13-8-10(12)11-7-9-5-3-2-4-6-9/h5H,2-4,6-8H2,1H3,(H,11,12) |
| InChIKey | LGYSKZPLEKRWLI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|