C20H26F2N2O3S — CID 100542464
(2R)-N-(1-adamantyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 100542464) has the molecular formula C20H26F2N2O3S and a molecular weight of 412.50 g/mol. Its IUPAC name is (2R)-N-(1-adamantyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-(1-adamantyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 100542464 |
| Molecular Formula | C20H26F2N2O3S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2R)-N-(1-adamantyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | C[C@H](C(=O)NC12CC3CC(CC(C3)C1)C2)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H26F2N2O3S/c1-12(24(28(2,26)27)16-3-4-17(21)18(22)8-16)19(25)23-20-9-13-5-14(10-20)7-15(6-13)11-20/h3-4,8,12-15H,5-7,9-11H2,1-2H3,(H,23,25)/t12-,13?,14?,15?,20?/m1/s1 |
| InChIKey | RTZNIEPVHLUWGP-JSFDKUKPSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |