C32H39N3O4S — CID 100546864
(2R)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 100546864) has the molecular formula C32H39N3O4S and a molecular weight of 561.75 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100546864 |
| Molecular Formula | C32H39N3O4S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(C)cc1)C(=O)CCCN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C32H39N3O4S/c1-3-27(32(37)33-26-12-5-4-6-13-26)34(22-24-19-17-23(2)18-20-24)30(36)16-9-21-35-28-14-7-10-25-11-8-15-29(31(25)28)40(35,38)39/h7-8,10-11,14-15,17-20,26-27H,3-6,9,12-13,16,21-22H2,1-2H3,(H,33,37)/t27-/m1/s1 |
| InChIKey | AUJCBOAEPYKBCS-HHHXNRCGSA-N |
| XLogP | 5.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |