C31H36ClN3O4S — CID 100553533
(2R)-2-[(2-chlorophenyl)methyl-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl]amino]-N-cyclohexylbutanamide (PubChem CID 100553533) has the molecular formula C31H36ClN3O4S and a molecular weight of 582.17 g/mol. Its IUPAC name is (2R)-2-[(2-chlorophenyl)methyl-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[(2-chlorophenyl)methyl-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100553533 |
| Molecular Formula | C31H36ClN3O4S |
| Molecular Weight | 582.17 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (2R)-2-[(2-chlorophenyl)methyl-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1Cl)C(=O)CCCN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C31H36ClN3O4S/c1-2-26(31(37)33-24-14-4-3-5-15-24)34(21-23-11-6-7-16-25(23)32)29(36)19-10-20-35-27-17-8-12-22-13-9-18-28(30(22)27)40(35,38)39/h6-9,11-13,16-18,24,26H,2-5,10,14-15,19-21H2,1H3,(H,33,37)/t26-/m1/s1 |
| InChIKey | ZKHNBDVJNNVLEF-AREMUKBSSA-N |
| XLogP | 6.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.17 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |