C31H36FN3O4S — CID 100566939
(2S)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide (PubChem CID 100566939) has the molecular formula C31H36FN3O4S and a molecular weight of 565.71 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100566939 |
| Molecular Formula | C31H36FN3O4S |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(F)cc1)C(=O)CCCN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C31H36FN3O4S/c1-2-26(31(37)33-25-11-4-3-5-12-25)34(21-22-16-18-24(32)19-17-22)29(36)15-8-20-35-27-13-6-9-23-10-7-14-28(30(23)27)40(35,38)39/h6-7,9-10,13-14,16-19,25-26H,2-5,8,11-12,15,20-21H2,1H3,(H,33,37)/t26-/m0/s1 |
| InChIKey | HVRXWUIDCHPFGC-SANMLTNESA-N |
| XLogP | 5.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |