C10H20N4 — CID 100553551
3,5-bis(2-methylpropyl)-1,2,4-triazol-4-amine (PubChem CID 100553551) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 3,5-bis(2-methylpropyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(2-methylpropyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 100553551 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3,5-bis(2-methylpropyl)-1,2,4-triazol-4-amine |
| SMILES | CC(C)Cc1nnc(CC(C)C)n1N |
| InChI | InChI=1S/C10H20N4/c1-7(2)5-9-12-13-10(14(9)11)6-8(3)4/h7-8H,5-6,11H2,1-4H3 |
| InChIKey | GDZRIDUCPCHANO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |