C8H16N4 — CID 14338417
3,5-di(propan-2-yl)-1,2,4-triazol-4-amine (PubChem CID 14338417) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-di(propan-2-yl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 14338417 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3,5-di(propan-2-yl)-1,2,4-triazol-4-amine |
| SMILES | CC(C)c1nnc(C(C)C)n1N |
| InChI | InChI=1S/C8H16N4/c1-5(2)7-10-11-8(6(3)4)12(7)9/h5-6H,9H2,1-4H3 |
| InChIKey | STDSYBXEQMBJHB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |