About 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine
3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine (PubChem CID 2794216) has the molecular formula C4H10N6
and a molecular weight of 142.17 g/mol. Its IUPAC name is 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine |
| PubChem CID | 2794216 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine |
| SMILES | CCc1nnc(NN)n1N |
| InChI | InChI=1S/C4H10N6/c1-2-3-8-9-4(7-5)10(3)6/h2,5-6H2,1H3,(H,7,9) |
| InChIKey | SWTGKQHEFXAYNH-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine?
The IUPAC name of 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine (CID 2794216) is 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine is CCc1nnc(NN)n1N.
What is the InChIKey of 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine?
The InChIKey is SWTGKQHEFXAYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N6/c1-2-3-8-9-4(7-5)10(3)6/h2,5-6H2,1H3,(H,7,9).
What are the key properties of 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine?
3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine has a molecular weight of 142.17 g/mol, XLogP of -1.16, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-hydrazinyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 2794216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).