C16H15F2NO4S — CID 100555715
(2S)-2-(4-fluoro-N-methylsulfonylanilino)-3-(4-fluorophenyl)propanoic acid (PubChem CID 100555715) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is (2S)-2-(4-fluoro-N-methylsulfonylanilino)-3-(4-fluorophenyl)propanoic acid.
| Compound Name | (2S)-2-(4-fluoro-N-methylsulfonylanilino)-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 100555715 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2S)-2-(4-fluoro-N-methylsulfonylanilino)-3-(4-fluorophenyl)propanoic acid |
| SMILES | CS(=O)(=O)N(c1ccc(F)cc1)[C@@H](Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C16H15F2NO4S/c1-24(22,23)19(14-8-6-13(18)7-9-14)15(16(20)21)10-11-2-4-12(17)5-3-11/h2-9,15H,10H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | GDJRBNPJPSRXKJ-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |