C18H20FNO5S — CID 100556939
(2S)-3-(2-ethoxyphenyl)-2-(4-fluoro-N-methylsulfonylanilino)propanoic acid (PubChem CID 100556939) has the molecular formula C18H20FNO5S and a molecular weight of 381.43 g/mol. Its IUPAC name is (2S)-3-(2-ethoxyphenyl)-2-(4-fluoro-N-methylsulfonylanilino)propanoic acid.
| Compound Name | (2S)-3-(2-ethoxyphenyl)-2-(4-fluoro-N-methylsulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 100556939 |
| Molecular Formula | C18H20FNO5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-3-(2-ethoxyphenyl)-2-(4-fluoro-N-methylsulfonylanilino)propanoic acid |
| SMILES | CCOc1ccccc1C[C@@H](C(=O)O)N(c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H20FNO5S/c1-3-25-17-7-5-4-6-13(17)12-16(18(21)22)20(26(2,23)24)15-10-8-14(19)9-11-15/h4-11,16H,3,12H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | CYOZXBSDCQVVNE-INIZCTEOSA-N |
| XLogP | 2.69 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |