C12H16FNO4S — CID 68897693
2-(4-fluoro-N-methylsulfonylanilino)pentanoic acid (PubChem CID 68897693) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(4-fluoro-N-methylsulfonylanilino)pentanoic acid.
| Compound Name | 2-(4-fluoro-N-methylsulfonylanilino)pentanoic acid |
|---|---|
| PubChem CID | 68897693 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-(4-fluoro-N-methylsulfonylanilino)pentanoic acid |
| SMILES | CCCC(C(=O)O)N(c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H16FNO4S/c1-3-4-11(12(15)16)14(19(2,17)18)10-7-5-9(13)6-8-10/h5-8,11H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | ZVMSNBWRGFKRDG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |