C36H40N2O14 — CID 10055688
dimethyl 6,21-dioxo-5,12,15,22,29,32,37,40-octaoxa-1,26-diazahexacyclo[24.8.8.02,11.04,9.016,25.018,23]dotetraconta-2(11),3,7,9,16(25),17,19,23-octaene-7,20-dicarboxylate (PubChem CID 10055688) has the molecular formula C36H40N2O14 and a molecular weight of 724.72 g/mol. Its IUPAC name is dimethyl 6,21-dioxo-5,12,15,22,29,32,37,40-octaoxa-1,26-diazahexacyclo[24.8.8.02,11.04,9.016,25.018,23]dotetraconta-2(11),3,7,9,16(25),17,19,23-octaene-7,20-dicarboxylate.
| Compound Name | dimethyl 6,21-dioxo-5,12,15,22,29,32,37,40-octaoxa-1,26-diazahexacyclo[24.8.8.02,11.04,9.016,25.018,23]dotetraconta-2(11),3,7,9,16(25),17,19,23-octaene-7,20-dicarboxylate |
|---|---|
| PubChem CID | 10055688 |
| Molecular Formula | C36H40N2O14 |
| Molecular Weight | 724.72 g/mol |
| Exact Mass | 724.25 |
| IUPAC Name | dimethyl 6,21-dioxo-5,12,15,22,29,32,37,40-octaoxa-1,26-diazahexacyclo[24.8.8.02,11.04,9.016,25.018,23]dotetraconta-2(11),3,7,9,16(25),17,19,23-octaene-7,20-dicarboxylate |
| SMILES | COC(=O)c1cc2cc3c(cc2oc1=O)N1CCOCCOCCN(CCOCCOCC1)c1cc2oc(=O)c(C(=O)OC)cc2cc1OCCO3 |
| InChI | InChI=1S/C36H40N2O14/c1-43-33(39)25-17-23-19-31-27(21-29(23)51-35(25)41)37-3-7-45-11-13-47-9-5-38(6-10-48-14-12-46-8-4-37)28-22-30-24(20-32(28)50-16-15-49-31)18-26(34(40)44-2)36(42)52-30/h17-22H,3-16H2,1-2H3 |
| InChIKey | MQMLEZLKGUUNTL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 174.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|