C23H29FN2O2S — CID 100558343
(2S)-N-butyl-2-[(2-fluorophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]propanamide (PubChem CID 100558343) has the molecular formula C23H29FN2O2S and a molecular weight of 416.56 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2-fluorophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]propanamide |
|---|---|
| PubChem CID | 100558343 |
| Molecular Formula | C23H29FN2O2S |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-(3-phenylsulfanylpropanoyl)amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C23H29FN2O2S/c1-3-4-15-25-23(28)18(2)26(17-19-10-8-9-13-21(19)24)22(27)14-16-29-20-11-6-5-7-12-20/h5-13,18H,3-4,14-17H2,1-2H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | RIAMSSIKFJYNKA-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|