C27H30N2O4 — CID 100561837
N-[(Z)-3-[2-(4-tert-butylphenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 100561837) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(Z)-3-[2-(4-tert-butylphenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-[2-(4-tert-butylphenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100561837 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[(Z)-3-[2-(4-tert-butylphenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2ccco2)C(=O)NCCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C27H30N2O4/c1-19-7-5-8-20(17-19)25(30)29-24(18-23-9-6-15-32-23)26(31)28-14-16-33-22-12-10-21(11-13-22)27(2,3)4/h5-13,15,17-18H,14,16H2,1-4H3,(H,28,31)(H,29,30)/b24-18- |
| InChIKey | LONIHOPYRGXTNV-MOHJPFBDSA-N |
| XLogP | 4.85 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|