C23H21FN2O4 — CID 100563565
N-[(Z)-3-[2-(4-fluorophenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 100563565) has the molecular formula C23H21FN2O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[(Z)-3-[2-(4-fluorophenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[(Z)-3-[2-(4-fluorophenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 100563565 |
| Molecular Formula | C23H21FN2O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[(Z)-3-[2-(4-fluorophenoxy)ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2ccco2)C(=O)NCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H21FN2O4/c1-16-4-2-5-17(14-16)22(27)26-21(15-20-6-3-12-29-20)23(28)25-11-13-30-19-9-7-18(24)8-10-19/h2-10,12,14-15H,11,13H2,1H3,(H,25,28)(H,26,27)/b21-15- |
| InChIKey | BUNCSYROXHGZAY-QNGOZBTKSA-N |
| XLogP | 3.69 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|