C26H28N2O4 — CID 100564781
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]prop-1-en-2-yl]-2-methylbenzamide (PubChem CID 100564781) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]prop-1-en-2-yl]-2-methylbenzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]prop-1-en-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100564781 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[2-(4-propylphenoxy)ethylamino]prop-1-en-2-yl]-2-methylbenzamide |
| SMILES | CCCc1ccc(OCCNC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-3-7-20-11-13-21(14-12-20)32-17-15-27-26(30)24(18-22-9-6-16-31-22)28-25(29)23-10-5-4-8-19(23)2/h4-6,8-14,16,18H,3,7,15,17H2,1-2H3,(H,27,30)(H,28,29)/b24-18- |
| InChIKey | JLZCJPCWKCICPB-MOHJPFBDSA-N |
| XLogP | 4.51 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|