C23H28ClFN2O3 — CID 100563262
(2S)-N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100563262) has the molecular formula C23H28ClFN2O3 and a molecular weight of 434.94 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100563262 |
| Molecular Formula | C23H28ClFN2O3 |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C23H28ClFN2O3/c1-4-5-12-26-23(29)17(3)27(14-18-8-6-7-9-21(18)25)22(28)15-30-19-10-11-20(24)16(2)13-19/h6-11,13,17H,4-5,12,14-15H2,1-3H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | FXOGOQJFJIASRQ-KRWDZBQOSA-N |
| XLogP | 4.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|