C22H25BrClFN2O3 — CID 100563282
(2S)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 100563282) has the molecular formula C22H25BrClFN2O3 and a molecular weight of 499.81 g/mol. Its IUPAC name is (2S)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100563282 |
| Molecular Formula | C22H25BrClFN2O3 |
| Molecular Weight | 499.81 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (2S)-2-[[2-(4-bromo-2-chlorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C22H25BrClFN2O3/c1-3-4-11-26-22(29)15(2)27(13-16-7-5-6-8-19(16)25)21(28)14-30-20-10-9-17(23)12-18(20)24/h5-10,12,15H,3-4,11,13-14H2,1-2H3,(H,26,29)/t15-/m0/s1 |
| InChIKey | ZGNMLFSZQJWAIZ-HNNXBMFYSA-N |
| XLogP | 4.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.81 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|