C24H31FN2O3 — CID 100564917
(2S)-N-butyl-2-[[2-(2,4-dimethylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100564917) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(2,4-dimethylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(2,4-dimethylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100564917 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(2,4-dimethylphenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C24H31FN2O3/c1-5-6-13-26-24(29)19(4)27(15-20-9-7-8-10-21(20)25)23(28)16-30-22-12-11-17(2)14-18(22)3/h7-12,14,19H,5-6,13,15-16H2,1-4H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | NEKIIRWOFFHIFP-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|