C24H20ClNO3 — CID 100573750
(E)-3-(2-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenylprop-2-enamide (PubChem CID 100573750) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 100573750 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenylprop-2-enamide |
| SMILES | O=C(NC[C@@H]1COc2ccccc2O1)/C(=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C24H20ClNO3/c25-21-11-5-4-10-18(21)14-20(17-8-2-1-3-9-17)24(27)26-15-19-16-28-22-12-6-7-13-23(22)29-19/h1-14,19H,15-16H2,(H,26,27)/b20-14+/t19-/m1/s1 |
| InChIKey | JXHARDJPIUUYJC-YFQSIASUSA-N |
| XLogP | 4.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|