C16H16N6O2 — CID 100574593
2-[2-(1H-indol-3-yl)ethyl]-1-(3-nitro-2-pyridinyl)guanidine (PubChem CID 100574593) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethyl]-1-(3-nitro-2-pyridinyl)guanidine.
| Compound Name | 2-[2-(1H-indol-3-yl)ethyl]-1-(3-nitro-2-pyridinyl)guanidine |
|---|---|
| PubChem CID | 100574593 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethyl]-1-(3-nitro-2-pyridinyl)guanidine |
| SMILES | N/C(=N\CCc1c[nH]c2ccccc12)Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N6O2/c17-16(21-15-14(22(23)24)6-3-8-18-15)19-9-7-11-10-20-13-5-2-1-4-12(11)13/h1-6,8,10,20H,7,9H2,(H3,17,18,19,21) |
| InChIKey | ATCXYSIKXLZOHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|