C16H17N6OPS — CID 71530357
2-[2-(1H-indol-3-yl)ethyl]-1-(2-sulfanylidene-3H-[1,3,2]oxazaphospholo[4,5-b]pyridin-2-yl)guanidine (PubChem CID 71530357) has the molecular formula C16H17N6OPS and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethyl]-1-(2-sulfanylidene-3H-[1,3,2]oxazaphospholo[4,5-b]pyridin-2-yl)guanidine.
| Compound Name | 2-[2-(1H-indol-3-yl)ethyl]-1-(2-sulfanylidene-3H-[1,3,2]oxazaphospholo[4,5-b]pyridin-2-yl)guanidine |
|---|---|
| PubChem CID | 71530357 |
| Molecular Formula | C16H17N6OPS |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethyl]-1-(2-sulfanylidene-3H-[1,3,2]oxazaphospholo[4,5-b]pyridin-2-yl)guanidine |
| SMILES | N/C(=N\CCc1c[nH]c2ccccc12)NP1(=S)Nc2ncccc2O1 |
| InChI | InChI=1S/C16H17N6OPS/c17-16(22-24(25)21-15-14(23-24)6-3-8-18-15)19-9-7-11-10-20-13-5-2-1-4-12(11)13/h1-6,8,10,20H,7,9H2,(H4,17,18,19,21,22,25) |
| InChIKey | DWPJDRMKISQLQG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|