(3-amino-2-cyclohexylpropyl)phosphonous acid

C9H20NO2P — CID 10058776

IUPAC(3-amino-2-cyclohexylpropyl)phosphonous acid
SMILESNCC(CP(O)O)C1CCCCC1
InChIInChI=1S/C9H20NO2P/c10-6-9(7-13(11)12)8-4-2-1-3-5-8/h8-9,11-12H,1-7,10H2
InChIKeyDKDBNKQPLHNBFJ-UHFFFAOYSA-N
MW205.24 g/mol
LogP1.44
Rot. Bonds4

About (3-amino-2-cyclohexylpropyl)phosphonous acid

(3-amino-2-cyclohexylpropyl)phosphonous acid (PubChem CID 10058776) has the molecular formula C9H20NO2P and a molecular weight of 205.24 g/mol. Its IUPAC name is (3-amino-2-cyclohexylpropyl)phosphonous acid.

Molecular Properties

Compound Name(3-amino-2-cyclohexylpropyl)phosphonous acid
PubChem CID10058776
Molecular FormulaC9H20NO2P
Molecular Weight205.24 g/mol
Exact Mass205.12
IUPAC Name(3-amino-2-cyclohexylpropyl)phosphonous acid
SMILESNCC(CP(O)O)C1CCCCC1
InChIInChI=1S/C9H20NO2P/c10-6-9(7-13(11)12)8-4-2-1-3-5-8/h8-9,11-12H,1-7,10H2
InChIKeyDKDBNKQPLHNBFJ-UHFFFAOYSA-N
XLogP1.44
TPSA66.48 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.24
LogP ≤ 51.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (3-amino-2-cyclohexylpropyl)phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-amino-2-cyclohexylpropyl)phosphonous acid?
The IUPAC name of (3-amino-2-cyclohexylpropyl)phosphonous acid (CID 10058776) is (3-amino-2-cyclohexylpropyl)phosphonous acid.
What is the SMILES notation for (3-amino-2-cyclohexylpropyl)phosphonous acid?
The canonical SMILES for (3-amino-2-cyclohexylpropyl)phosphonous acid is NCC(CP(O)O)C1CCCCC1.
What is the InChIKey of (3-amino-2-cyclohexylpropyl)phosphonous acid?
The InChIKey is DKDBNKQPLHNBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20NO2P/c10-6-9(7-13(11)12)8-4-2-1-3-5-8/h8-9,11-12H,1-7,10H2.
What are the key properties of (3-amino-2-cyclohexylpropyl)phosphonous acid?
(3-amino-2-cyclohexylpropyl)phosphonous acid has a molecular weight of 205.24 g/mol, XLogP of 1.44, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-cyclohexylpropyl)phosphonous acid is sourced from PubChem (CID 10058776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).