C9H22Cl2N2O — CID 24837070
2,3-diamino-1-cyclohexylpropan-1-ol;dihydrochloride (PubChem CID 24837070) has the molecular formula C9H22Cl2N2O and a molecular weight of 245.19 g/mol. Its IUPAC name is 2,3-diamino-1-cyclohexylpropan-1-ol;dihydrochloride.
| Compound Name | 2,3-diamino-1-cyclohexylpropan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 24837070 |
| Molecular Formula | C9H22Cl2N2O |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2,3-diamino-1-cyclohexylpropan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)C(O)C1CCCCC1 |
| InChI | InChI=1S/C9H20N2O.2ClH/c10-6-8(11)9(12)7-4-2-1-3-5-7;;/h7-9,12H,1-6,10-11H2;2*1H |
| InChIKey | BHUAXNZGPDYQLQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |