C8H15ClF2O — CID 162337180
1-cyclohexyl-2,2-difluoroethanol;hydrochloride (PubChem CID 162337180) has the molecular formula C8H15ClF2O and a molecular weight of 200.66 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-difluoroethanol;hydrochloride.
| Compound Name | 1-cyclohexyl-2,2-difluoroethanol;hydrochloride |
|---|---|
| PubChem CID | 162337180 |
| Molecular Formula | C8H15ClF2O |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-cyclohexyl-2,2-difluoroethanol;hydrochloride |
| SMILES | Cl.OC(C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C8H14F2O.ClH/c9-8(10)7(11)6-4-2-1-3-5-6;/h6-8,11H,1-5H2;1H |
| InChIKey | FWYRDVMRUQZVQP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |