C9H20N2 — CID 117245609
2-cyclobutyl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 117245609) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-cyclobutyl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 2-cyclobutyl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 117245609 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2-cyclobutyl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CC(CN)C1CCC1 |
| InChI | InChI=1S/C9H20N2/c1-11(2)7-9(6-10)8-4-3-5-8/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | RGRKGSNPCCYISW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |