C17H19N3O2S — CID 100595830
ethyl 2-methyl-3-(pyridin-3-ylmethylcarbamothioylamino)benzoate (PubChem CID 100595830) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is ethyl 2-methyl-3-(pyridin-3-ylmethylcarbamothioylamino)benzoate.
| Compound Name | ethyl 2-methyl-3-(pyridin-3-ylmethylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100595830 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl 2-methyl-3-(pyridin-3-ylmethylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCc2cccnc2)c1C |
| InChI | InChI=1S/C17H19N3O2S/c1-3-22-16(21)14-7-4-8-15(12(14)2)20-17(23)19-11-13-6-5-9-18-10-13/h4-10H,3,11H2,1-2H3,(H2,19,20,23) |
| InChIKey | LDUNYYROPWIJQH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|